About [2-[4-(5-propanoyloxyhexyl)phenyl]pyrimidin-5-yl] dodec-3-enoate
[2-[4-(5-propanoyloxyhexyl)phenyl]pyrimidin-5-yl] dodec-3-enoate (PubChem CID 54206398) has the molecular formula C31H44N2O4
and a molecular weight of 508.70 g/mol. Its IUPAC name is [2-[4-(5-propanoyloxyhexyl)phenyl]pyrimidin-5-yl] dodec-3-enoate.
Molecular Properties
| Compound Name | [2-[4-(5-propanoyloxyhexyl)phenyl]pyrimidin-5-yl] dodec-3-enoate |
| PubChem CID | 54206398 |
| Molecular Formula | C31H44N2O4 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.33 |
| IUPAC Name | [2-[4-(5-propanoyloxyhexyl)phenyl]pyrimidin-5-yl] dodec-3-enoate |
| SMILES | CCCCCCCCC=CCC(=O)Oc1cnc(-c2ccc(CCCCC(C)OC(=O)CC)cc2)nc1 |
| InChI | InChI=1S/C31H44N2O4/c1-4-6-7-8-9-10-11-12-13-18-30(35)37-28-23-32-31(33-24-28)27-21-19-26(20-22-27)17-15-14-16-25(3)36-29(34)5-2/h12-13,19-25H,4-11,14-18H2,1-3H3 |
| InChIKey | PSTYKNBBJGFLMS-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-[4-(5-propanoyloxyhexyl)phenyl]pyrimidin-5-yl] dodec-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(5-propanoyloxyhexyl)phenyl]pyrimidin-5-yl] dodec-3-enoate?
The IUPAC name of [2-[4-(5-propanoyloxyhexyl)phenyl]pyrimidin-5-yl] dodec-3-enoate (CID 54206398) is [2-[4-(5-propanoyloxyhexyl)phenyl]pyrimidin-5-yl] dodec-3-enoate.
What is the SMILES notation for [2-[4-(5-propanoyloxyhexyl)phenyl]pyrimidin-5-yl] dodec-3-enoate?
The canonical SMILES for [2-[4-(5-propanoyloxyhexyl)phenyl]pyrimidin-5-yl] dodec-3-enoate is CCCCCCCCC=CCC(=O)Oc1cnc(-c2ccc(CCCCC(C)OC(=O)CC)cc2)nc1.
What is the InChIKey of [2-[4-(5-propanoyloxyhexyl)phenyl]pyrimidin-5-yl] dodec-3-enoate?
The InChIKey is PSTYKNBBJGFLMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H44N2O4/c1-4-6-7-8-9-10-11-12-13-18-30(35)37-28-23-32-31(33-24-28)27-21-19-26(20-22-27)17-15-14-16-25(3)36-29(34)5-2/h12-13,19-25H,4-11,14-18H2,1-3H3.
What are the key properties of [2-[4-(5-propanoyloxyhexyl)phenyl]pyrimidin-5-yl] dodec-3-enoate?
[2-[4-(5-propanoyloxyhexyl)phenyl]pyrimidin-5-yl] dodec-3-enoate has a molecular weight of 508.70 g/mol, XLogP of 7.80, 18 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(5-propanoyloxyhexyl)phenyl]pyrimidin-5-yl] dodec-3-enoate is sourced from PubChem (CID 54206398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).