About [2-[4-(3-propanoyloxybutyl)phenyl]pyrimidin-5-yl] oct-6-enoate
[2-[4-(3-propanoyloxybutyl)phenyl]pyrimidin-5-yl] oct-6-enoate (PubChem CID 54287109) has the molecular formula C25H32N2O4
and a molecular weight of 424.54 g/mol. Its IUPAC name is [2-[4-(3-propanoyloxybutyl)phenyl]pyrimidin-5-yl] oct-6-enoate.
Molecular Properties
| Compound Name | [2-[4-(3-propanoyloxybutyl)phenyl]pyrimidin-5-yl] oct-6-enoate |
| PubChem CID | 54287109 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | [2-[4-(3-propanoyloxybutyl)phenyl]pyrimidin-5-yl] oct-6-enoate |
| SMILES | CC=CCCCCC(=O)Oc1cnc(-c2ccc(CCC(C)OC(=O)CC)cc2)nc1 |
| InChI | InChI=1S/C25H32N2O4/c1-4-6-7-8-9-10-24(29)31-22-17-26-25(27-18-22)21-15-13-20(14-16-21)12-11-19(3)30-23(28)5-2/h4,6,13-19H,5,7-12H2,1-3H3 |
| InChIKey | RUXDLZSFZLDQMC-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-[4-(3-propanoyloxybutyl)phenyl]pyrimidin-5-yl] oct-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(3-propanoyloxybutyl)phenyl]pyrimidin-5-yl] oct-6-enoate?
The IUPAC name of [2-[4-(3-propanoyloxybutyl)phenyl]pyrimidin-5-yl] oct-6-enoate (CID 54287109) is [2-[4-(3-propanoyloxybutyl)phenyl]pyrimidin-5-yl] oct-6-enoate.
What is the SMILES notation for [2-[4-(3-propanoyloxybutyl)phenyl]pyrimidin-5-yl] oct-6-enoate?
The canonical SMILES for [2-[4-(3-propanoyloxybutyl)phenyl]pyrimidin-5-yl] oct-6-enoate is CC=CCCCCC(=O)Oc1cnc(-c2ccc(CCC(C)OC(=O)CC)cc2)nc1.
What is the InChIKey of [2-[4-(3-propanoyloxybutyl)phenyl]pyrimidin-5-yl] oct-6-enoate?
The InChIKey is RUXDLZSFZLDQMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32N2O4/c1-4-6-7-8-9-10-24(29)31-22-17-26-25(27-18-22)21-15-13-20(14-16-21)12-11-19(3)30-23(28)5-2/h4,6,13-19H,5,7-12H2,1-3H3.
What are the key properties of [2-[4-(3-propanoyloxybutyl)phenyl]pyrimidin-5-yl] oct-6-enoate?
[2-[4-(3-propanoyloxybutyl)phenyl]pyrimidin-5-yl] oct-6-enoate has a molecular weight of 424.54 g/mol, XLogP of 5.46, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(3-propanoyloxybutyl)phenyl]pyrimidin-5-yl] oct-6-enoate is sourced from PubChem (CID 54287109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).