About [2-[4-(5-prop-2-enoyloxyhexyl)phenyl]pyrimidin-5-yl] undec-10-enoate
[2-[4-(5-prop-2-enoyloxyhexyl)phenyl]pyrimidin-5-yl] undec-10-enoate (PubChem CID 19017290) has the molecular formula C30H40N2O4
and a molecular weight of 492.66 g/mol. Its IUPAC name is [2-[4-(5-prop-2-enoyloxyhexyl)phenyl]pyrimidin-5-yl] undec-10-enoate.
Molecular Properties
| Compound Name | [2-[4-(5-prop-2-enoyloxyhexyl)phenyl]pyrimidin-5-yl] undec-10-enoate |
| PubChem CID | 19017290 |
| Molecular Formula | C30H40N2O4 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | [2-[4-(5-prop-2-enoyloxyhexyl)phenyl]pyrimidin-5-yl] undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)Oc1cnc(-c2ccc(CCCCC(C)OC(=O)C=C)cc2)nc1 |
| InChI | InChI=1S/C30H40N2O4/c1-4-6-7-8-9-10-11-12-17-29(34)36-27-22-31-30(32-23-27)26-20-18-25(19-21-26)16-14-13-15-24(3)35-28(33)5-2/h4-5,18-24H,1-2,6-17H2,3H3 |
| InChIKey | JNAXSNJNBTVETD-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-[4-(5-prop-2-enoyloxyhexyl)phenyl]pyrimidin-5-yl] undec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(5-prop-2-enoyloxyhexyl)phenyl]pyrimidin-5-yl] undec-10-enoate?
The IUPAC name of [2-[4-(5-prop-2-enoyloxyhexyl)phenyl]pyrimidin-5-yl] undec-10-enoate (CID 19017290) is [2-[4-(5-prop-2-enoyloxyhexyl)phenyl]pyrimidin-5-yl] undec-10-enoate.
What is the SMILES notation for [2-[4-(5-prop-2-enoyloxyhexyl)phenyl]pyrimidin-5-yl] undec-10-enoate?
The canonical SMILES for [2-[4-(5-prop-2-enoyloxyhexyl)phenyl]pyrimidin-5-yl] undec-10-enoate is C=CCCCCCCCCC(=O)Oc1cnc(-c2ccc(CCCCC(C)OC(=O)C=C)cc2)nc1.
What is the InChIKey of [2-[4-(5-prop-2-enoyloxyhexyl)phenyl]pyrimidin-5-yl] undec-10-enoate?
The InChIKey is JNAXSNJNBTVETD-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H40N2O4/c1-4-6-7-8-9-10-11-12-17-29(34)36-27-22-31-30(32-23-27)26-20-18-25(19-21-26)16-14-13-15-24(3)35-28(33)5-2/h4-5,18-24H,1-2,6-17H2,3H3.
What are the key properties of [2-[4-(5-prop-2-enoyloxyhexyl)phenyl]pyrimidin-5-yl] undec-10-enoate?
[2-[4-(5-prop-2-enoyloxyhexyl)phenyl]pyrimidin-5-yl] undec-10-enoate has a molecular weight of 492.66 g/mol, XLogP of 7.19, 18 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(5-prop-2-enoyloxyhexyl)phenyl]pyrimidin-5-yl] undec-10-enoate is sourced from PubChem (CID 19017290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).