About [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] oct-4-enoate
[6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] oct-4-enoate (PubChem CID 54182585) has the molecular formula C27H37NO3
and a molecular weight of 423.60 g/mol. Its IUPAC name is [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] oct-4-enoate.
Molecular Properties
| Compound Name | [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] oct-4-enoate |
| PubChem CID | 54182585 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] oct-4-enoate |
| SMILES | CCCC=CCCC(=O)Oc1ccc(-c2ccc(CCCCCOCCC)cc2)nc1 |
| InChI | InChI=1S/C27H37NO3/c1-3-5-6-7-10-13-27(29)31-25-18-19-26(28-22-25)24-16-14-23(15-17-24)12-9-8-11-21-30-20-4-2/h6-7,14-19,22H,3-5,8-13,20-21H2,1-2H3 |
| InChIKey | PCWBEPREEWUUNO-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] oct-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] oct-4-enoate?
The IUPAC name of [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] oct-4-enoate (CID 54182585) is [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] oct-4-enoate.
What is the SMILES notation for [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] oct-4-enoate?
The canonical SMILES for [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] oct-4-enoate is CCCC=CCCC(=O)Oc1ccc(-c2ccc(CCCCCOCCC)cc2)nc1.
What is the InChIKey of [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] oct-4-enoate?
The InChIKey is PCWBEPREEWUUNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H37NO3/c1-3-5-6-7-10-13-27(29)31-25-18-19-26(28-22-25)24-16-14-23(15-17-24)12-9-8-11-21-30-20-4-2/h6-7,14-19,22H,3-5,8-13,20-21H2,1-2H3.
What are the key properties of [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] oct-4-enoate?
[6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] oct-4-enoate has a molecular weight of 423.60 g/mol, XLogP of 6.93, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] oct-4-enoate is sourced from PubChem (CID 54182585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).