C28H41NO2 — CID 19017124
5-[(E)-non-2-enoxy]-2-[4-(5-propoxypentyl)phenyl]pyridine (PubChem CID 19017124) has the molecular formula C28H41NO2 and a molecular weight of 423.64 g/mol. Its IUPAC name is 5-[(E)-non-2-enoxy]-2-[4-(5-propoxypentyl)phenyl]pyridine.
| Compound Name | 5-[(E)-non-2-enoxy]-2-[4-(5-propoxypentyl)phenyl]pyridine |
|---|---|
| PubChem CID | 19017124 |
| Molecular Formula | C28H41NO2 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | 5-[(E)-non-2-enoxy]-2-[4-(5-propoxypentyl)phenyl]pyridine |
| SMILES | CCCCCC/C=C/COc1ccc(-c2ccc(CCCCCOCCC)cc2)nc1 |
| InChI | InChI=1S/C28H41NO2/c1-3-5-6-7-8-9-13-23-31-27-19-20-28(29-24-27)26-17-15-25(16-18-26)14-11-10-12-22-30-21-4-2/h9,13,15-20,24H,3-8,10-12,14,21-23H2,1-2H3/b13-9+ |
| InChIKey | FLKGGCIGDJIWKA-UKTHLTGXSA-N |
| XLogP | 7.79 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|