C31H48N2O3 — CID 67681607
5-[(E)-dodec-2-enoxy]-2-[4-(4-pentoxybutoxy)phenyl]pyrimidine (PubChem CID 67681607) has the molecular formula C31H48N2O3 and a molecular weight of 496.74 g/mol. Its IUPAC name is 5-[(E)-dodec-2-enoxy]-2-[4-(4-pentoxybutoxy)phenyl]pyrimidine.
| Compound Name | 5-[(E)-dodec-2-enoxy]-2-[4-(4-pentoxybutoxy)phenyl]pyrimidine |
|---|---|
| PubChem CID | 67681607 |
| Molecular Formula | C31H48N2O3 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.37 |
| IUPAC Name | 5-[(E)-dodec-2-enoxy]-2-[4-(4-pentoxybutoxy)phenyl]pyrimidine |
| SMILES | CCCCCCCCC/C=C/COc1cnc(-c2ccc(OCCCCOCCCCC)cc2)nc1 |
| InChI | InChI=1S/C31H48N2O3/c1-3-5-7-8-9-10-11-12-13-15-24-36-30-26-32-31(33-27-30)28-18-20-29(21-19-28)35-25-17-16-23-34-22-14-6-4-2/h13,15,18-21,26-27H,3-12,14,16-17,22-25H2,1-2H3/b15-13+ |
| InChIKey | DLOYQXNVVPTSHF-FYWRMAATSA-N |
| XLogP | 8.59 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|