C30H44N2O4 — CID 67681627
(E)-11-[4-[5-(4-pentoxybutoxy)pyrimidin-2-yl]phenyl]undec-2-enoic acid (PubChem CID 67681627) has the molecular formula C30H44N2O4 and a molecular weight of 496.69 g/mol. Its IUPAC name is (E)-11-[4-[5-(4-pentoxybutoxy)pyrimidin-2-yl]phenyl]undec-2-enoic acid.
| Compound Name | (E)-11-[4-[5-(4-pentoxybutoxy)pyrimidin-2-yl]phenyl]undec-2-enoic acid |
|---|---|
| PubChem CID | 67681627 |
| Molecular Formula | C30H44N2O4 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.33 |
| IUPAC Name | (E)-11-[4-[5-(4-pentoxybutoxy)pyrimidin-2-yl]phenyl]undec-2-enoic acid |
| SMILES | CCCCCOCCCCOc1cnc(-c2ccc(CCCCCCCC/C=C/C(=O)O)cc2)nc1 |
| InChI | InChI=1S/C30H44N2O4/c1-2-3-12-21-35-22-13-14-23-36-28-24-31-30(32-25-28)27-19-17-26(18-20-27)15-10-8-6-4-5-7-9-11-16-29(33)34/h11,16-20,24-25H,2-10,12-15,21-23H2,1H3,(H,33,34)/b16-11+ |
| InChIKey | WSKYVGOJQVWFGL-LFIBNONCSA-N |
| XLogP | 7.42 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|