C27H36N2O — CID 70223910
5-but-2-enoxy-2-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl]pyrimidine (PubChem CID 70223910) has the molecular formula C27H36N2O and a molecular weight of 404.60 g/mol. Its IUPAC name is 5-but-2-enoxy-2-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl]pyrimidine.
| Compound Name | 5-but-2-enoxy-2-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 70223910 |
| Molecular Formula | C27H36N2O |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | 5-but-2-enoxy-2-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl]pyrimidine |
| SMILES | CC=CCOc1cnc(-c2ccc(C34CCC(CCCCC)(CC3)CC4)cc2)nc1 |
| InChI | InChI=1S/C27H36N2O/c1-3-5-7-12-26-13-16-27(17-14-26,18-15-26)23-10-8-22(9-11-23)25-28-20-24(21-29-25)30-19-6-4-2/h4,6,8-11,20-21H,3,5,7,12-19H2,1-2H3 |
| InChIKey | XIRNKTSSEAGLLY-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|