C29H35F3O — CID 70191386
1-pentyl-4-[4-[4-(4,4,4-trifluorobut-2-enoxy)phenyl]phenyl]bicyclo[2.2.2]octane (PubChem CID 70191386) has the molecular formula C29H35F3O and a molecular weight of 456.59 g/mol. Its IUPAC name is 1-pentyl-4-[4-[4-(4,4,4-trifluorobut-2-enoxy)phenyl]phenyl]bicyclo[2.2.2]octane.
| Compound Name | 1-pentyl-4-[4-[4-(4,4,4-trifluorobut-2-enoxy)phenyl]phenyl]bicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 70191386 |
| Molecular Formula | C29H35F3O |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 1-pentyl-4-[4-[4-(4,4,4-trifluorobut-2-enoxy)phenyl]phenyl]bicyclo[2.2.2]octane |
| SMILES | CCCCCC12CCC(c3ccc(-c4ccc(OCC=CC(F)(F)F)cc4)cc3)(CC1)CC2 |
| InChI | InChI=1S/C29H35F3O/c1-2-3-4-14-27-16-19-28(20-17-27,21-18-27)25-10-6-23(7-11-25)24-8-12-26(13-9-24)33-22-5-15-29(30,31)32/h5-13,15H,2-4,14,16-22H2,1H3 |
| InChIKey | YOUUZXUBVJMHEZ-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|