C16H13F3O — CID 122222314
1-phenyl-4-[(E)-4,4,4-trifluorobut-2-enoxy]benzene (PubChem CID 122222314) has the molecular formula C16H13F3O and a molecular weight of 278.27 g/mol. Its IUPAC name is 1-phenyl-4-[(E)-4,4,4-trifluorobut-2-enoxy]benzene.
| Compound Name | 1-phenyl-4-[(E)-4,4,4-trifluorobut-2-enoxy]benzene |
|---|---|
| PubChem CID | 122222314 |
| Molecular Formula | C16H13F3O |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-phenyl-4-[(E)-4,4,4-trifluorobut-2-enoxy]benzene |
| SMILES | FC(F)(F)/C=C/COc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H13F3O/c17-16(18,19)11-4-12-20-15-9-7-14(8-10-15)13-5-2-1-3-6-13/h1-11H,12H2/b11-4+ |
| InChIKey | DSKHTBMLKHRDRM-NYYWCZLTSA-N |
| XLogP | 4.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|