C27H33F3O — CID 54559106
1-propyl-4-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]bicyclo[2.2.2]octane (PubChem CID 54559106) has the molecular formula C27H33F3O and a molecular weight of 430.55 g/mol. Its IUPAC name is 1-propyl-4-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]bicyclo[2.2.2]octane.
| Compound Name | 1-propyl-4-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]bicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 54559106 |
| Molecular Formula | C27H33F3O |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 1-propyl-4-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]bicyclo[2.2.2]octane |
| SMILES | CCCC12CCC(c3ccc(-c4ccc(OCCCC(F)(F)F)cc4)cc3)(CC1)CC2 |
| InChI | InChI=1S/C27H33F3O/c1-2-12-25-14-17-26(18-15-25,19-16-25)23-8-4-21(5-9-23)22-6-10-24(11-7-22)31-20-3-13-27(28,29)30/h4-11H,2-3,12-20H2,1H3 |
| InChIKey | ZPGSUINBIXZAMS-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|