C29H40F3NO — CID 70190504
4-octyl-1-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]piperidine (PubChem CID 70190504) has the molecular formula C29H40F3NO and a molecular weight of 475.64 g/mol. Its IUPAC name is 4-octyl-1-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]piperidine.
| Compound Name | 4-octyl-1-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]piperidine |
|---|---|
| PubChem CID | 70190504 |
| Molecular Formula | C29H40F3NO |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.31 |
| IUPAC Name | 4-octyl-1-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]piperidine |
| SMILES | CCCCCCCCC1CCN(c2ccc(-c3ccc(OCCCC(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C29H40F3NO/c1-2-3-4-5-6-7-9-24-18-21-33(22-19-24)27-14-10-25(11-15-27)26-12-16-28(17-13-26)34-23-8-20-29(30,31)32/h10-17,24H,2-9,18-23H2,1H3 |
| InChIKey | BHWYRDSVAAIKOX-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|