C33H50O4 — CID 154375613
[(2R,5S)-5-[4-(4-heptyl-1-bicyclo[2.2.2]octanyl)phenyl]-1,4-dioxan-2-yl] oct-2-enoate (PubChem CID 154375613) has the molecular formula C33H50O4 and a molecular weight of 510.76 g/mol. Its IUPAC name is [(2R,5S)-5-[4-(4-heptyl-1-bicyclo[2.2.2]octanyl)phenyl]-1,4-dioxan-2-yl] oct-2-enoate.
| Compound Name | [(2R,5S)-5-[4-(4-heptyl-1-bicyclo[2.2.2]octanyl)phenyl]-1,4-dioxan-2-yl] oct-2-enoate |
|---|---|
| PubChem CID | 154375613 |
| Molecular Formula | C33H50O4 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | [(2R,5S)-5-[4-(4-heptyl-1-bicyclo[2.2.2]octanyl)phenyl]-1,4-dioxan-2-yl] oct-2-enoate |
| SMILES | CCCCCC=CC(=O)O[C@@H]1CO[C@@H](c2ccc(C34CCC(CCCCCCC)(CC3)CC4)cc2)CO1 |
| InChI | InChI=1S/C33H50O4/c1-3-5-7-9-11-13-30(34)37-31-26-35-29(25-36-31)27-14-16-28(17-15-27)33-22-19-32(20-23-33,21-24-33)18-12-10-8-6-4-2/h11,13-17,29,31H,3-10,12,18-26H2,1-2H3/t29-,31-,32?,33?/m1/s1 |
| InChIKey | MWFAUCNDUYMQME-HJFJHXFHSA-N |
| XLogP | 8.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|