C27H32O2 — CID 162336087
[4-[4-(4-propyl-1-bicyclo[2.2.2]octanyl)phenyl]phenyl] (E)-but-2-enoate (PubChem CID 162336087) has the molecular formula C27H32O2 and a molecular weight of 388.55 g/mol. Its IUPAC name is [4-[4-(4-propyl-1-bicyclo[2.2.2]octanyl)phenyl]phenyl] (E)-but-2-enoate.
| Compound Name | [4-[4-(4-propyl-1-bicyclo[2.2.2]octanyl)phenyl]phenyl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 162336087 |
| Molecular Formula | C27H32O2 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | [4-[4-(4-propyl-1-bicyclo[2.2.2]octanyl)phenyl]phenyl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)Oc1ccc(-c2ccc(C34CCC(CCC)(CC3)CC4)cc2)cc1 |
| InChI | InChI=1S/C27H32O2/c1-3-5-25(28)29-24-12-8-22(9-13-24)21-6-10-23(11-7-21)27-18-15-26(14-4-2,16-19-27)17-20-27/h3,5-13H,4,14-20H2,1-2H3/b5-3+ |
| InChIKey | WYTABJXWWDUCEC-HWKANZROSA-N |
| XLogP | 7.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|