About 2-butyl-2-hydroxy-1,3-dioxolane-4,5-dione
2-butyl-2-hydroxy-1,3-dioxolane-4,5-dione (PubChem CID 139899991) has the molecular formula C7H10O5
and a molecular weight of 174.15 g/mol. Its IUPAC name is 2-butyl-2-hydroxy-1,3-dioxolane-4,5-dione.
Molecular Properties
| Compound Name | 2-butyl-2-hydroxy-1,3-dioxolane-4,5-dione |
| PubChem CID | 139899991 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 2-butyl-2-hydroxy-1,3-dioxolane-4,5-dione |
| SMILES | CCCCC1(O)OC(=O)C(=O)O1 |
| InChI | InChI=1S/C7H10O5/c1-2-3-4-7(10)11-5(8)6(9)12-7/h10H,2-4H2,1H3 |
| InChIKey | KSJQFGMVJSFSMV-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-2-hydroxy-1,3-dioxolane-4,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-2-hydroxy-1,3-dioxolane-4,5-dione?
The IUPAC name of 2-butyl-2-hydroxy-1,3-dioxolane-4,5-dione (CID 139899991) is 2-butyl-2-hydroxy-1,3-dioxolane-4,5-dione.
What is the SMILES notation for 2-butyl-2-hydroxy-1,3-dioxolane-4,5-dione?
The canonical SMILES for 2-butyl-2-hydroxy-1,3-dioxolane-4,5-dione is CCCCC1(O)OC(=O)C(=O)O1.
What is the InChIKey of 2-butyl-2-hydroxy-1,3-dioxolane-4,5-dione?
The InChIKey is KSJQFGMVJSFSMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O5/c1-2-3-4-7(10)11-5(8)6(9)12-7/h10H,2-4H2,1H3.
What are the key properties of 2-butyl-2-hydroxy-1,3-dioxolane-4,5-dione?
2-butyl-2-hydroxy-1,3-dioxolane-4,5-dione has a molecular weight of 174.15 g/mol, XLogP of -0.08, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-2-hydroxy-1,3-dioxolane-4,5-dione is sourced from PubChem (CID 139899991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).