C7H10O5 — CID 139899991
2-butyl-2-hydroxy-1,3-dioxolane-4,5-dione (PubChem CID 139899991) has the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. Its IUPAC name is 2-butyl-2-hydroxy-1,3-dioxolane-4,5-dione.
| Compound Name | 2-butyl-2-hydroxy-1,3-dioxolane-4,5-dione |
|---|---|
| PubChem CID | 139899991 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 2-butyl-2-hydroxy-1,3-dioxolane-4,5-dione |
| SMILES | CCCCC1(O)OC(=O)C(=O)O1 |
| InChI | InChI=1S/C7H10O5/c1-2-3-4-7(10)11-5(8)6(9)12-7/h10H,2-4H2,1H3 |
| InChIKey | KSJQFGMVJSFSMV-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|