C8H12O6 — CID 142473267
2-hydroxy-2-(5-hydroxypentyl)-1,3-dioxolane-4,5-dione (PubChem CID 142473267) has the molecular formula C8H12O6 and a molecular weight of 204.18 g/mol. Its IUPAC name is 2-hydroxy-2-(5-hydroxypentyl)-1,3-dioxolane-4,5-dione.
| Compound Name | 2-hydroxy-2-(5-hydroxypentyl)-1,3-dioxolane-4,5-dione |
|---|---|
| PubChem CID | 142473267 |
| Molecular Formula | C8H12O6 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 2-hydroxy-2-(5-hydroxypentyl)-1,3-dioxolane-4,5-dione |
| SMILES | O=C1OC(O)(CCCCCO)OC1=O |
| InChI | InChI=1S/C8H12O6/c9-5-3-1-2-4-8(12)13-6(10)7(11)14-8/h9,12H,1-5H2 |
| InChIKey | ABOIEIVWWGWPIQ-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|