C7H10O6 — CID 142473264
2-hydroxy-2-(4-hydroxybutyl)-1,3-dioxolane-4,5-dione (PubChem CID 142473264) has the molecular formula C7H10O6 and a molecular weight of 190.15 g/mol. Its IUPAC name is 2-hydroxy-2-(4-hydroxybutyl)-1,3-dioxolane-4,5-dione.
| Compound Name | 2-hydroxy-2-(4-hydroxybutyl)-1,3-dioxolane-4,5-dione |
|---|---|
| PubChem CID | 142473264 |
| Molecular Formula | C7H10O6 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 2-hydroxy-2-(4-hydroxybutyl)-1,3-dioxolane-4,5-dione |
| SMILES | O=C1OC(O)(CCCCO)OC1=O |
| InChI | InChI=1S/C7H10O6/c8-4-2-1-3-7(11)12-5(9)6(10)13-7/h8,11H,1-4H2 |
| InChIKey | SECKJGWVSAFCBW-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|