C16H26O6 — CID 140684233
(6Z)-3-hydroxy-2-(2-hydroxyethyl)-3-(6-methylheptyl)-2H-1,4-dioxocine-5,8-dione (PubChem CID 140684233) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is (6Z)-3-hydroxy-2-(2-hydroxyethyl)-3-(6-methylheptyl)-2H-1,4-dioxocine-5,8-dione.
| Compound Name | (6Z)-3-hydroxy-2-(2-hydroxyethyl)-3-(6-methylheptyl)-2H-1,4-dioxocine-5,8-dione |
|---|---|
| PubChem CID | 140684233 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (6Z)-3-hydroxy-2-(2-hydroxyethyl)-3-(6-methylheptyl)-2H-1,4-dioxocine-5,8-dione |
| SMILES | CC(C)CCCCCC1(O)OC(=O)/C=C\C(=O)OC1CCO |
| InChI | InChI=1S/C16H26O6/c1-12(2)6-4-3-5-10-16(20)13(9-11-17)21-14(18)7-8-15(19)22-16/h7-8,12-13,17,20H,3-6,9-11H2,1-2H3/b8-7- |
| InChIKey | IXYCQIMJVCUGEL-FPLPWBNLSA-N |
| XLogP | 1.69 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|