About (2R)-2-[(6S,7S)-7-hydroxy-6-methyloctyl]-2H-furan-5-one
(2R)-2-[(6S,7S)-7-hydroxy-6-methyloctyl]-2H-furan-5-one (PubChem CID 100582847) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is (2R)-2-[(6S,7S)-7-hydroxy-6-methyloctyl]-2H-furan-5-one.
Molecular Properties
| Compound Name | (2R)-2-[(6S,7S)-7-hydroxy-6-methyloctyl]-2H-furan-5-one |
| PubChem CID | 100582847 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (2R)-2-[(6S,7S)-7-hydroxy-6-methyloctyl]-2H-furan-5-one |
| SMILES | C[C@H](O)[C@@H](C)CCCCC[C@@H]1C=CC(=O)O1 |
| InChI | InChI=1S/C13H22O3/c1-10(11(2)14)6-4-3-5-7-12-8-9-13(15)16-12/h8-12,14H,3-7H2,1-2H3/t10-,11-,12+/m0/s1 |
| InChIKey | AEPMKZIOUKHDOO-SDDRHHMPSA-N |
| XLogP | 2.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(6S,7S)-7-hydroxy-6-methyloctyl]-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(6S,7S)-7-hydroxy-6-methyloctyl]-2H-furan-5-one?
The IUPAC name of (2R)-2-[(6S,7S)-7-hydroxy-6-methyloctyl]-2H-furan-5-one (CID 100582847) is (2R)-2-[(6S,7S)-7-hydroxy-6-methyloctyl]-2H-furan-5-one.
What is the SMILES notation for (2R)-2-[(6S,7S)-7-hydroxy-6-methyloctyl]-2H-furan-5-one?
The canonical SMILES for (2R)-2-[(6S,7S)-7-hydroxy-6-methyloctyl]-2H-furan-5-one is C[C@H](O)[C@@H](C)CCCCC[C@@H]1C=CC(=O)O1.
What is the InChIKey of (2R)-2-[(6S,7S)-7-hydroxy-6-methyloctyl]-2H-furan-5-one?
The InChIKey is AEPMKZIOUKHDOO-SDDRHHMPSA-N. The full InChI is InChI=1S/C13H22O3/c1-10(11(2)14)6-4-3-5-7-12-8-9-13(15)16-12/h8-12,14H,3-7H2,1-2H3/t10-,11-,12+/m0/s1.
What are the key properties of (2R)-2-[(6S,7S)-7-hydroxy-6-methyloctyl]-2H-furan-5-one?
(2R)-2-[(6S,7S)-7-hydroxy-6-methyloctyl]-2H-furan-5-one has a molecular weight of 226.32 g/mol, XLogP of 2.44, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(6S,7S)-7-hydroxy-6-methyloctyl]-2H-furan-5-one is sourced from PubChem (CID 100582847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).