C13H22O3 — CID 10799274
(2S)-2-(6-hydroxy-6-methyloctyl)-2H-furan-5-one (PubChem CID 10799274) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (2S)-2-(6-hydroxy-6-methyloctyl)-2H-furan-5-one.
| Compound Name | (2S)-2-(6-hydroxy-6-methyloctyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 10799274 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (2S)-2-(6-hydroxy-6-methyloctyl)-2H-furan-5-one |
| SMILES | CCC(C)(O)CCCCC[C@H]1C=CC(=O)O1 |
| InChI | InChI=1S/C13H22O3/c1-3-13(2,15)10-6-4-5-7-11-8-9-12(14)16-11/h8-9,11,15H,3-7,10H2,1-2H3/t11-,13?/m0/s1 |
| InChIKey | SYVFGLXUEAXFAP-AMGKYWFPSA-N |
| XLogP | 2.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|