About 3-butyl-N,N-dimethyloxetan-3-amine
3-butyl-N,N-dimethyloxetan-3-amine (PubChem CID 167242715) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is 3-butyl-N,N-dimethyloxetan-3-amine.
Molecular Properties
| Compound Name | 3-butyl-N,N-dimethyloxetan-3-amine |
| PubChem CID | 167242715 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 3-butyl-N,N-dimethyloxetan-3-amine |
| SMILES | CCCCC1(N(C)C)COC1 |
| InChI | InChI=1S/C9H19NO/c1-4-5-6-9(10(2)3)7-11-8-9/h4-8H2,1-3H3 |
| InChIKey | NNFHSRKJQFNCAG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butyl-N,N-dimethyloxetan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-N,N-dimethyloxetan-3-amine?
The IUPAC name of 3-butyl-N,N-dimethyloxetan-3-amine (CID 167242715) is 3-butyl-N,N-dimethyloxetan-3-amine.
What is the SMILES notation for 3-butyl-N,N-dimethyloxetan-3-amine?
The canonical SMILES for 3-butyl-N,N-dimethyloxetan-3-amine is CCCCC1(N(C)C)COC1.
What is the InChIKey of 3-butyl-N,N-dimethyloxetan-3-amine?
The InChIKey is NNFHSRKJQFNCAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO/c1-4-5-6-9(10(2)3)7-11-8-9/h4-8H2,1-3H3.
What are the key properties of 3-butyl-N,N-dimethyloxetan-3-amine?
3-butyl-N,N-dimethyloxetan-3-amine has a molecular weight of 157.26 g/mol, XLogP of 1.51, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-N,N-dimethyloxetan-3-amine is sourced from PubChem (CID 167242715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).