C18H36O2 — CID 151505286
2,2-dibutyl-5,5-dipropyl-1,4-dioxane (PubChem CID 151505286) has the molecular formula C18H36O2 and a molecular weight of 284.48 g/mol. Its IUPAC name is 2,2-dibutyl-5,5-dipropyl-1,4-dioxane.
| Compound Name | 2,2-dibutyl-5,5-dipropyl-1,4-dioxane |
|---|---|
| PubChem CID | 151505286 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | 2,2-dibutyl-5,5-dipropyl-1,4-dioxane |
| SMILES | CCCCC1(CCCC)COC(CCC)(CCC)CO1 |
| InChI | InChI=1S/C18H36O2/c1-5-9-13-18(14-10-6-2)16-19-17(11-7-3,12-8-4)15-20-18/h5-16H2,1-4H3 |
| InChIKey | PRHFUKCIQYZEFB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |