C16H32O2 — CID 151443761
2,2-dibutyl-5,5-diethyl-1,4-dioxane (PubChem CID 151443761) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is 2,2-dibutyl-5,5-diethyl-1,4-dioxane.
| Compound Name | 2,2-dibutyl-5,5-diethyl-1,4-dioxane |
|---|---|
| PubChem CID | 151443761 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 2,2-dibutyl-5,5-diethyl-1,4-dioxane |
| SMILES | CCCCC1(CCCC)COC(CC)(CC)CO1 |
| InChI | InChI=1S/C16H32O2/c1-5-9-11-16(12-10-6-2)14-17-15(7-3,8-4)13-18-16/h5-14H2,1-4H3 |
| InChIKey | PFBHYXIXMAYXAB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |