C13H23NO2 — CID 102421346
(E)-5-(2-butyloxiran-2-yl)-N,N-dimethylpent-2-enamide (PubChem CID 102421346) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is (E)-5-(2-butyloxiran-2-yl)-N,N-dimethylpent-2-enamide.
| Compound Name | (E)-5-(2-butyloxiran-2-yl)-N,N-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 102421346 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (E)-5-(2-butyloxiran-2-yl)-N,N-dimethylpent-2-enamide |
| SMILES | CCCCC1(CC/C=C/C(=O)N(C)C)CO1 |
| InChI | InChI=1S/C13H23NO2/c1-4-5-9-13(11-16-13)10-7-6-8-12(15)14(2)3/h6,8H,4-5,7,9-11H2,1-3H3/b8-6+ |
| InChIKey | JGZFFCVUVAFNRN-SOFGYWHQSA-N |
| XLogP | 2.37 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|