About 4-butyl-4-propyltrioxane
4-butyl-4-propyltrioxane (PubChem CID 150377371) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is 4-butyl-4-propyltrioxane.
Molecular Properties
| Compound Name | 4-butyl-4-propyltrioxane |
| PubChem CID | 150377371 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 4-butyl-4-propyltrioxane |
| SMILES | CCCCC1(CCC)CCOOO1 |
| InChI | InChI=1S/C10H20O3/c1-3-5-7-10(6-4-2)8-9-11-13-12-10/h3-9H2,1-2H3 |
| InChIKey | GYZJICDTTOTQEE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-4-propyltrioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-4-propyltrioxane?
The IUPAC name of 4-butyl-4-propyltrioxane (CID 150377371) is 4-butyl-4-propyltrioxane.
What is the SMILES notation for 4-butyl-4-propyltrioxane?
The canonical SMILES for 4-butyl-4-propyltrioxane is CCCCC1(CCC)CCOOO1.
What is the InChIKey of 4-butyl-4-propyltrioxane?
The InChIKey is GYZJICDTTOTQEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-3-5-7-10(6-4-2)8-9-11-13-12-10/h3-9H2,1-2H3.
What are the key properties of 4-butyl-4-propyltrioxane?
4-butyl-4-propyltrioxane has a molecular weight of 188.27 g/mol, XLogP of 3.00, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-4-propyltrioxane is sourced from PubChem (CID 150377371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).