About 3-undecyldioxolan-3-ol
3-undecyldioxolan-3-ol (PubChem CID 88690671) has the molecular formula C14H28O3
and a molecular weight of 244.37 g/mol. Its IUPAC name is 3-undecyldioxolan-3-ol.
Molecular Properties
| Compound Name | 3-undecyldioxolan-3-ol |
| PubChem CID | 88690671 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 3-undecyldioxolan-3-ol |
| SMILES | CCCCCCCCCCCC1(O)CCOO1 |
| InChI | InChI=1S/C14H28O3/c1-2-3-4-5-6-7-8-9-10-11-14(15)12-13-16-17-14/h15H,2-13H2,1H3 |
| InChIKey | MTHGEJUBQQRAOL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-undecyldioxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-undecyldioxolan-3-ol?
The IUPAC name of 3-undecyldioxolan-3-ol (CID 88690671) is 3-undecyldioxolan-3-ol.
What is the SMILES notation for 3-undecyldioxolan-3-ol?
The canonical SMILES for 3-undecyldioxolan-3-ol is CCCCCCCCCCCC1(O)CCOO1.
What is the InChIKey of 3-undecyldioxolan-3-ol?
The InChIKey is MTHGEJUBQQRAOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O3/c1-2-3-4-5-6-7-8-9-10-11-14(15)12-13-16-17-14/h15H,2-13H2,1H3.
What are the key properties of 3-undecyldioxolan-3-ol?
3-undecyldioxolan-3-ol has a molecular weight of 244.37 g/mol, XLogP of 3.95, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-undecyldioxolan-3-ol is sourced from PubChem (CID 88690671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).