About 2-pentyloxan-2-ol
2-pentyloxan-2-ol (PubChem CID 10035063) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-pentyloxan-2-ol.
Molecular Properties
| Compound Name | 2-pentyloxan-2-ol |
| PubChem CID | 10035063 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 2-pentyloxan-2-ol |
| SMILES | CCCCCC1(O)CCCCO1 |
| InChI | InChI=1S/C10H20O2/c1-2-3-4-7-10(11)8-5-6-9-12-10/h11H,2-9H2,1H3 |
| InChIKey | FGEKLMIVIVFUMA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentyloxan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentyloxan-2-ol?
The IUPAC name of 2-pentyloxan-2-ol (CID 10035063) is 2-pentyloxan-2-ol.
What is the SMILES notation for 2-pentyloxan-2-ol?
The canonical SMILES for 2-pentyloxan-2-ol is CCCCCC1(O)CCCCO1.
What is the InChIKey of 2-pentyloxan-2-ol?
The InChIKey is FGEKLMIVIVFUMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2/c1-2-3-4-7-10(11)8-5-6-9-12-10/h11H,2-9H2,1H3.
What are the key properties of 2-pentyloxan-2-ol?
2-pentyloxan-2-ol has a molecular weight of 172.27 g/mol, XLogP of 2.46, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentyloxan-2-ol is sourced from PubChem (CID 10035063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).