About (2-hexyloxan-2-yl)silane
(2-hexyloxan-2-yl)silane (PubChem CID 123313847) has the molecular formula C11H24OSi
and a molecular weight of 200.40 g/mol. Its IUPAC name is (2-hexyloxan-2-yl)silane.
Molecular Properties
| Compound Name | (2-hexyloxan-2-yl)silane |
| PubChem CID | 123313847 |
| Molecular Formula | C11H24OSi |
| Molecular Weight | 200.40 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | (2-hexyloxan-2-yl)silane |
| SMILES | CCCCCCC1([SiH3])CCCCO1 |
| InChI | InChI=1S/C11H24OSi/c1-2-3-4-5-8-11(13)9-6-7-10-12-11/h2-10H2,1,13H3 |
| InChIKey | NJZJQUCUKJIUPE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-hexyloxan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hexyloxan-2-yl)silane?
The IUPAC name of (2-hexyloxan-2-yl)silane (CID 123313847) is (2-hexyloxan-2-yl)silane.
What is the SMILES notation for (2-hexyloxan-2-yl)silane?
The canonical SMILES for (2-hexyloxan-2-yl)silane is CCCCCCC1([SiH3])CCCCO1.
What is the InChIKey of (2-hexyloxan-2-yl)silane?
The InChIKey is NJZJQUCUKJIUPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24OSi/c1-2-3-4-5-8-11(13)9-6-7-10-12-11/h2-10H2,1,13H3.
What are the key properties of (2-hexyloxan-2-yl)silane?
(2-hexyloxan-2-yl)silane has a molecular weight of 200.40 g/mol, XLogP of 2.22, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hexyloxan-2-yl)silane is sourced from PubChem (CID 123313847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).