C12H24O3Si — CID 123966696
[2-[4-(oxiran-2-ylmethoxy)butyl]oxan-2-yl]silane (PubChem CID 123966696) has the molecular formula C12H24O3Si and a molecular weight of 244.41 g/mol. Its IUPAC name is [2-[4-(oxiran-2-ylmethoxy)butyl]oxan-2-yl]silane.
| Compound Name | [2-[4-(oxiran-2-ylmethoxy)butyl]oxan-2-yl]silane |
|---|---|
| PubChem CID | 123966696 |
| Molecular Formula | C12H24O3Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | [2-[4-(oxiran-2-ylmethoxy)butyl]oxan-2-yl]silane |
| SMILES | [SiH3]C1(CCCCOCC2CO2)CCCCO1 |
| InChI | InChI=1S/C12H24O3Si/c16-12(6-2-4-8-15-12)5-1-3-7-13-9-11-10-14-11/h11H,1-10H2,16H3 |
| InChIKey | WSHXCQOCCWNOHX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|