About 1,1-dipentylcyclononane
1,1-dipentylcyclononane (PubChem CID 169026027) has the molecular formula C19H38
and a molecular weight of 266.51 g/mol. Its IUPAC name is 1,1-dipentylcyclononane.
Molecular Properties
| Compound Name | 1,1-dipentylcyclononane |
| PubChem CID | 169026027 |
| Molecular Formula | C19H38 |
| Molecular Weight | 266.51 g/mol |
| Exact Mass | 266.30 |
| IUPAC Name | 1,1-dipentylcyclononane |
| SMILES | CCCCCC1(CCCCC)CCCCCCCC1 |
| InChI | InChI=1S/C19H38/c1-3-5-11-15-19(16-12-6-4-2)17-13-9-7-8-10-14-18-19/h3-18H2,1-2H3 |
| InChIKey | XQVIPHFLYODTDE-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.51 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dipentylcyclononane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dipentylcyclononane?
The IUPAC name of 1,1-dipentylcyclononane (CID 169026027) is 1,1-dipentylcyclononane.
What is the SMILES notation for 1,1-dipentylcyclononane?
The canonical SMILES for 1,1-dipentylcyclononane is CCCCCC1(CCCCC)CCCCCCCC1.
What is the InChIKey of 1,1-dipentylcyclononane?
The InChIKey is XQVIPHFLYODTDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38/c1-3-5-11-15-19(16-12-6-4-2)17-13-9-7-8-10-14-18-19/h3-18H2,1-2H3.
What are the key properties of 1,1-dipentylcyclononane?
1,1-dipentylcyclononane has a molecular weight of 266.51 g/mol, XLogP of 7.27, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dipentylcyclononane is sourced from PubChem (CID 169026027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).