About 1,1-di(nonyl)cyclopentane
1,1-di(nonyl)cyclopentane (PubChem CID 154318487) has the molecular formula C23H46
and a molecular weight of 322.62 g/mol. Its IUPAC name is 1,1-di(nonyl)cyclopentane.
Molecular Properties
| Compound Name | 1,1-di(nonyl)cyclopentane |
| PubChem CID | 154318487 |
| Molecular Formula | C23H46 |
| Molecular Weight | 322.62 g/mol |
| Exact Mass | 322.36 |
| IUPAC Name | 1,1-di(nonyl)cyclopentane |
| SMILES | CCCCCCCCCC1(CCCCCCCCC)CCCC1 |
| InChI | InChI=1S/C23H46/c1-3-5-7-9-11-13-15-19-23(21-17-18-22-23)20-16-14-12-10-8-6-4-2/h3-22H2,1-2H3 |
| InChIKey | HZBGIBYITGXEKW-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.62 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,1-di(nonyl)cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-di(nonyl)cyclopentane?
The IUPAC name of 1,1-di(nonyl)cyclopentane (CID 154318487) is 1,1-di(nonyl)cyclopentane.
What is the SMILES notation for 1,1-di(nonyl)cyclopentane?
The canonical SMILES for 1,1-di(nonyl)cyclopentane is CCCCCCCCCC1(CCCCCCCCC)CCCC1.
What is the InChIKey of 1,1-di(nonyl)cyclopentane?
The InChIKey is HZBGIBYITGXEKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H46/c1-3-5-7-9-11-13-15-19-23(21-17-18-22-23)20-16-14-12-10-8-6-4-2/h3-22H2,1-2H3.
What are the key properties of 1,1-di(nonyl)cyclopentane?
1,1-di(nonyl)cyclopentane has a molecular weight of 322.62 g/mol, XLogP of 8.83, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-di(nonyl)cyclopentane is sourced from PubChem (CID 154318487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).