About 3-methyl-3-octyloxetane
3-methyl-3-octyloxetane (PubChem CID 162658167) has the molecular formula C12H24O
and a molecular weight of 184.32 g/mol. Its IUPAC name is 3-methyl-3-octyloxetane.
Molecular Properties
| Compound Name | 3-methyl-3-octyloxetane |
| PubChem CID | 162658167 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | 3-methyl-3-octyloxetane |
| SMILES | CCCCCCCCC1(C)COC1 |
| InChI | InChI=1S/C12H24O/c1-3-4-5-6-7-8-9-12(2)10-13-11-12/h3-11H2,1-2H3 |
| InChIKey | QHZWWADMQUZVHP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-3-octyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3-octyloxetane?
The IUPAC name of 3-methyl-3-octyloxetane (CID 162658167) is 3-methyl-3-octyloxetane.
What is the SMILES notation for 3-methyl-3-octyloxetane?
The canonical SMILES for 3-methyl-3-octyloxetane is CCCCCCCCC1(C)COC1.
What is the InChIKey of 3-methyl-3-octyloxetane?
The InChIKey is QHZWWADMQUZVHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O/c1-3-4-5-6-7-8-9-12(2)10-13-11-12/h3-11H2,1-2H3.
What are the key properties of 3-methyl-3-octyloxetane?
3-methyl-3-octyloxetane has a molecular weight of 184.32 g/mol, XLogP of 3.77, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3-octyloxetane is sourced from PubChem (CID 162658167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).