About 4-dodecyl-4-methyl-1,3-oxazolidine
4-dodecyl-4-methyl-1,3-oxazolidine (PubChem CID 66910716) has the molecular formula C16H33NO
and a molecular weight of 255.45 g/mol. Its IUPAC name is 4-dodecyl-4-methyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | 4-dodecyl-4-methyl-1,3-oxazolidine |
| PubChem CID | 66910716 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | 4-dodecyl-4-methyl-1,3-oxazolidine |
| SMILES | CCCCCCCCCCCCC1(C)COCN1 |
| InChI | InChI=1S/C16H33NO/c1-3-4-5-6-7-8-9-10-11-12-13-16(2)14-18-15-17-16/h17H,3-15H2,1-2H3 |
| InChIKey | IHTSCEWRXSKLGG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-dodecyl-4-methyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-dodecyl-4-methyl-1,3-oxazolidine?
The IUPAC name of 4-dodecyl-4-methyl-1,3-oxazolidine (CID 66910716) is 4-dodecyl-4-methyl-1,3-oxazolidine.
What is the SMILES notation for 4-dodecyl-4-methyl-1,3-oxazolidine?
The canonical SMILES for 4-dodecyl-4-methyl-1,3-oxazolidine is CCCCCCCCCCCCC1(C)COCN1.
What is the InChIKey of 4-dodecyl-4-methyl-1,3-oxazolidine?
The InChIKey is IHTSCEWRXSKLGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO/c1-3-4-5-6-7-8-9-10-11-12-13-16(2)14-18-15-17-16/h17H,3-15H2,1-2H3.
What are the key properties of 4-dodecyl-4-methyl-1,3-oxazolidine?
4-dodecyl-4-methyl-1,3-oxazolidine has a molecular weight of 255.45 g/mol, XLogP of 4.63, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-dodecyl-4-methyl-1,3-oxazolidine is sourced from PubChem (CID 66910716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).