About 4-ethyl-4-methyl-1,3-oxazolidine
4-ethyl-4-methyl-1,3-oxazolidine (PubChem CID 66630148) has the molecular formula C6H13NO
and a molecular weight of 115.18 g/mol. Its IUPAC name is 4-ethyl-4-methyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | 4-ethyl-4-methyl-1,3-oxazolidine |
| PubChem CID | 66630148 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | 4-ethyl-4-methyl-1,3-oxazolidine |
| SMILES | CCC1(C)COCN1 |
| InChI | InChI=1S/C6H13NO/c1-3-6(2)4-8-5-7-6/h7H,3-5H2,1-2H3 |
| InChIKey | NGEUAKWVPMTVBT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-4-methyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-4-methyl-1,3-oxazolidine?
The IUPAC name of 4-ethyl-4-methyl-1,3-oxazolidine (CID 66630148) is 4-ethyl-4-methyl-1,3-oxazolidine.
What is the SMILES notation for 4-ethyl-4-methyl-1,3-oxazolidine?
The canonical SMILES for 4-ethyl-4-methyl-1,3-oxazolidine is CCC1(C)COCN1.
What is the InChIKey of 4-ethyl-4-methyl-1,3-oxazolidine?
The InChIKey is NGEUAKWVPMTVBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO/c1-3-6(2)4-8-5-7-6/h7H,3-5H2,1-2H3.
What are the key properties of 4-ethyl-4-methyl-1,3-oxazolidine?
4-ethyl-4-methyl-1,3-oxazolidine has a molecular weight of 115.18 g/mol, XLogP of 0.73, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-4-methyl-1,3-oxazolidine is sourced from PubChem (CID 66630148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).