About (4-ethyl-1,3-oxazolidin-4-yl)methanol
(4-ethyl-1,3-oxazolidin-4-yl)methanol (PubChem CID 55300885) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is (4-ethyl-1,3-oxazolidin-4-yl)methanol.
Molecular Properties
| Compound Name | (4-ethyl-1,3-oxazolidin-4-yl)methanol |
| PubChem CID | 55300885 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | (4-ethyl-1,3-oxazolidin-4-yl)methanol |
| SMILES | CCC1(CO)COCN1 |
| InChI | InChI=1S/C6H13NO2/c1-2-6(3-8)4-9-5-7-6/h7-8H,2-5H2,1H3 |
| InChIKey | PEAVWPFPPKVEQL-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-ethyl-1,3-oxazolidin-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethyl-1,3-oxazolidin-4-yl)methanol?
The IUPAC name of (4-ethyl-1,3-oxazolidin-4-yl)methanol (CID 55300885) is (4-ethyl-1,3-oxazolidin-4-yl)methanol.
What is the SMILES notation for (4-ethyl-1,3-oxazolidin-4-yl)methanol?
The canonical SMILES for (4-ethyl-1,3-oxazolidin-4-yl)methanol is CCC1(CO)COCN1.
What is the InChIKey of (4-ethyl-1,3-oxazolidin-4-yl)methanol?
The InChIKey is PEAVWPFPPKVEQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c1-2-6(3-8)4-9-5-7-6/h7-8H,2-5H2,1H3.
What are the key properties of (4-ethyl-1,3-oxazolidin-4-yl)methanol?
(4-ethyl-1,3-oxazolidin-4-yl)methanol has a molecular weight of 131.18 g/mol, XLogP of -0.30, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethyl-1,3-oxazolidin-4-yl)methanol is sourced from PubChem (CID 55300885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).