C7H15NO — CID 18006699
4,4-diethyl-1,3-oxazolidine (PubChem CID 18006699) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is 4,4-diethyl-1,3-oxazolidine.
| Compound Name | 4,4-diethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 18006699 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | 4,4-diethyl-1,3-oxazolidine |
| SMILES | CCC1(CC)COCN1 |
| InChI | InChI=1S/C7H15NO/c1-3-7(4-2)5-9-6-8-7/h8H,3-6H2,1-2H3 |
| InChIKey | UPGBQNIPUNZHTL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |