C11H26Cl2N2 — CID 86633674
4-butyl-N,N-dimethylpiperidin-4-amine;dihydrochloride (PubChem CID 86633674) has the molecular formula C11H26Cl2N2 and a molecular weight of 257.25 g/mol. Its IUPAC name is 4-butyl-N,N-dimethylpiperidin-4-amine;dihydrochloride.
| Compound Name | 4-butyl-N,N-dimethylpiperidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 86633674 |
| Molecular Formula | C11H26Cl2N2 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 4-butyl-N,N-dimethylpiperidin-4-amine;dihydrochloride |
| SMILES | CCCCC1(N(C)C)CCNCC1.Cl.Cl |
| InChI | InChI=1S/C11H24N2.2ClH/c1-4-5-6-11(13(2)3)7-9-12-10-8-11;;/h12H,4-10H2,1-3H3;2*1H |
| InChIKey | NIMDOOVAVKGOED-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |