C9H20ClN — CID 75419509
4,4-diethylpiperidine;hydrochloride (PubChem CID 75419509) has the molecular formula C9H20ClN and a molecular weight of 177.72 g/mol. Its IUPAC name is 4,4-diethylpiperidine;hydrochloride.
| Compound Name | 4,4-diethylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 75419509 |
| Molecular Formula | C9H20ClN |
| Molecular Weight | 177.72 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 4,4-diethylpiperidine;hydrochloride |
| SMILES | CCC1(CC)CCNCC1.Cl |
| InChI | InChI=1S/C9H19N.ClH/c1-3-9(4-2)5-7-10-8-6-9;/h10H,3-8H2,1-2H3;1H |
| InChIKey | YSNWSGQDWUSLKF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.72 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |