C12H24N2OS — CID 63129878
4-[(4-ethylpiperidin-4-yl)methyl]-1,4-thiazinane 1-oxide (PubChem CID 63129878) has the molecular formula C12H24N2OS and a molecular weight of 244.40 g/mol. Its IUPAC name is 4-[(4-ethylpiperidin-4-yl)methyl]-1,4-thiazinane 1-oxide.
| Compound Name | 4-[(4-ethylpiperidin-4-yl)methyl]-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 63129878 |
| Molecular Formula | C12H24N2OS |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 4-[(4-ethylpiperidin-4-yl)methyl]-1,4-thiazinane 1-oxide |
| SMILES | CCC1(CN2CCS(=O)CC2)CCNCC1 |
| InChI | InChI=1S/C12H24N2OS/c1-2-12(3-5-13-6-4-12)11-14-7-9-16(15)10-8-14/h13H,2-11H2,1H3 |
| InChIKey | YPMOUIPTQYGXAG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |