C16H26O2S — CID 11300550
(2R,4R)-2-tert-butyl-4-methyl-4-[(1E,3E)-octa-1,3-dienyl]-1,3-oxathiolan-5-one (PubChem CID 11300550) has the molecular formula C16H26O2S and a molecular weight of 282.45 g/mol. Its IUPAC name is (2R,4R)-2-tert-butyl-4-methyl-4-[(1E,3E)-octa-1,3-dienyl]-1,3-oxathiolan-5-one.
| Compound Name | (2R,4R)-2-tert-butyl-4-methyl-4-[(1E,3E)-octa-1,3-dienyl]-1,3-oxathiolan-5-one |
|---|---|
| PubChem CID | 11300550 |
| Molecular Formula | C16H26O2S |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (2R,4R)-2-tert-butyl-4-methyl-4-[(1E,3E)-octa-1,3-dienyl]-1,3-oxathiolan-5-one |
| SMILES | CCCC/C=C/C=C/[C@@]1(C)S[C@H](C(C)(C)C)OC1=O |
| InChI | InChI=1S/C16H26O2S/c1-6-7-8-9-10-11-12-16(5)13(17)18-14(19-16)15(2,3)4/h9-12,14H,6-8H2,1-5H3/b10-9+,12-11+/t14-,16-/m1/s1 |
| InChIKey | UUZQVKATJQSOKD-TVFGITOISA-N |
| XLogP | 4.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|