About 2-bromo-1,1-dihexylcyclopropane
2-bromo-1,1-dihexylcyclopropane (PubChem CID 71500159) has the molecular formula C15H29Br
and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-bromo-1,1-dihexylcyclopropane.
Molecular Properties
| Compound Name | 2-bromo-1,1-dihexylcyclopropane |
| PubChem CID | 71500159 |
| Molecular Formula | C15H29Br |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-bromo-1,1-dihexylcyclopropane |
| SMILES | CCCCCCC1(CCCCCC)CC1Br |
| InChI | InChI=1S/C15H29Br/c1-3-5-7-9-11-15(13-14(15)16)12-10-8-6-4-2/h14H,3-13H2,1-2H3 |
| InChIKey | HBMXPAJAYCXZQM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1,1-dihexylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,1-dihexylcyclopropane?
The IUPAC name of 2-bromo-1,1-dihexylcyclopropane (CID 71500159) is 2-bromo-1,1-dihexylcyclopropane.
What is the SMILES notation for 2-bromo-1,1-dihexylcyclopropane?
The canonical SMILES for 2-bromo-1,1-dihexylcyclopropane is CCCCCCC1(CCCCCC)CC1Br.
What is the InChIKey of 2-bromo-1,1-dihexylcyclopropane?
The InChIKey is HBMXPAJAYCXZQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29Br/c1-3-5-7-9-11-15(13-14(15)16)12-10-8-6-4-2/h14H,3-13H2,1-2H3.
What are the key properties of 2-bromo-1,1-dihexylcyclopropane?
2-bromo-1,1-dihexylcyclopropane has a molecular weight of 289.30 g/mol, XLogP of 6.08, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,1-dihexylcyclopropane is sourced from PubChem (CID 71500159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).