About 1-ethyl-1-hexyl-2,3-dimethylcyclopropane
1-ethyl-1-hexyl-2,3-dimethylcyclopropane (PubChem CID 123758014) has the molecular formula C13H26
and a molecular weight of 182.35 g/mol. Its IUPAC name is 1-ethyl-1-hexyl-2,3-dimethylcyclopropane.
Molecular Properties
| Compound Name | 1-ethyl-1-hexyl-2,3-dimethylcyclopropane |
| PubChem CID | 123758014 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | 1-ethyl-1-hexyl-2,3-dimethylcyclopropane |
| SMILES | CCCCCCC1(CC)C(C)C1C |
| InChI | InChI=1S/C13H26/c1-5-7-8-9-10-13(6-2)11(3)12(13)4/h11-12H,5-10H2,1-4H3 |
| InChIKey | FGHNLLIENHNQCS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1-hexyl-2,3-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1-hexyl-2,3-dimethylcyclopropane?
The IUPAC name of 1-ethyl-1-hexyl-2,3-dimethylcyclopropane (CID 123758014) is 1-ethyl-1-hexyl-2,3-dimethylcyclopropane.
What is the SMILES notation for 1-ethyl-1-hexyl-2,3-dimethylcyclopropane?
The canonical SMILES for 1-ethyl-1-hexyl-2,3-dimethylcyclopropane is CCCCCCC1(CC)C(C)C1C.
What is the InChIKey of 1-ethyl-1-hexyl-2,3-dimethylcyclopropane?
The InChIKey is FGHNLLIENHNQCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26/c1-5-7-8-9-10-13(6-2)11(3)12(13)4/h11-12H,5-10H2,1-4H3.
What are the key properties of 1-ethyl-1-hexyl-2,3-dimethylcyclopropane?
1-ethyl-1-hexyl-2,3-dimethylcyclopropane has a molecular weight of 182.35 g/mol, XLogP of 4.64, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-hexyl-2,3-dimethylcyclopropane is sourced from PubChem (CID 123758014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).