C26H46N2O2 — CID 102249704
1,3-diethyl-2,4-diisocyanato-1,3-dioctylcyclobutane (PubChem CID 102249704) has the molecular formula C26H46N2O2 and a molecular weight of 418.67 g/mol. Its IUPAC name is 1,3-diethyl-2,4-diisocyanato-1,3-dioctylcyclobutane.
| Compound Name | 1,3-diethyl-2,4-diisocyanato-1,3-dioctylcyclobutane |
|---|---|
| PubChem CID | 102249704 |
| Molecular Formula | C26H46N2O2 |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.36 |
| IUPAC Name | 1,3-diethyl-2,4-diisocyanato-1,3-dioctylcyclobutane |
| SMILES | CCCCCCCCC1(CC)C(N=C=O)C(CC)(CCCCCCCC)C1N=C=O |
| InChI | InChI=1S/C26H46N2O2/c1-5-9-11-13-15-17-19-25(7-3)23(27-21-29)26(8-4,24(25)28-22-30)20-18-16-14-12-10-6-2/h23-24H,5-20H2,1-4H3 |
| InChIKey | WCPJXZMMVHIHSO-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|