C15H27NO — CID 139909281
1,1-dibutyl-4-isocyanatocyclohexane (PubChem CID 139909281) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 1,1-dibutyl-4-isocyanatocyclohexane.
| Compound Name | 1,1-dibutyl-4-isocyanatocyclohexane |
|---|---|
| PubChem CID | 139909281 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 1,1-dibutyl-4-isocyanatocyclohexane |
| SMILES | CCCCC1(CCCC)CCC(N=C=O)CC1 |
| InChI | InChI=1S/C15H27NO/c1-3-5-9-15(10-6-4-2)11-7-14(8-12-15)16-13-17/h14H,3-12H2,1-2H3 |
| InChIKey | XUQUVUVMMVHTGI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|