C12H17NO — CID 87595515
5-butyl-6-isocyanato-5-methylcyclohexa-1,3-diene (PubChem CID 87595515) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 5-butyl-6-isocyanato-5-methylcyclohexa-1,3-diene.
| Compound Name | 5-butyl-6-isocyanato-5-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 87595515 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 5-butyl-6-isocyanato-5-methylcyclohexa-1,3-diene |
| SMILES | CCCCC1(C)C=CC=CC1N=C=O |
| InChI | InChI=1S/C12H17NO/c1-3-4-8-12(2)9-6-5-7-11(12)13-10-14/h5-7,9,11H,3-4,8H2,1-2H3 |
| InChIKey | RRGSFDUODMQRRQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|