C16H21NO — CID 141470566
1-(2-isocyanatopropan-2-yl)-5,5-bis(prop-1-en-2-yl)cyclohexa-1,3-diene (PubChem CID 141470566) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-(2-isocyanatopropan-2-yl)-5,5-bis(prop-1-en-2-yl)cyclohexa-1,3-diene.
| Compound Name | 1-(2-isocyanatopropan-2-yl)-5,5-bis(prop-1-en-2-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 141470566 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 1-(2-isocyanatopropan-2-yl)-5,5-bis(prop-1-en-2-yl)cyclohexa-1,3-diene |
| SMILES | C=C(C)C1(C(=C)C)C=CC=C(C(C)(C)N=C=O)C1 |
| InChI | InChI=1S/C16H21NO/c1-12(2)16(13(3)4)9-7-8-14(10-16)15(5,6)17-11-18/h7-9H,1,3,10H2,2,4-6H3 |
| InChIKey | OZIUIHUQWQVCNO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|