C23H45NO3P2 — CID 174669471
1,1-bis[ethyl(hexyl)phosphoryl]-4-isocyanatocyclohexane (PubChem CID 174669471) has the molecular formula C23H45NO3P2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 1,1-bis[ethyl(hexyl)phosphoryl]-4-isocyanatocyclohexane.
| Compound Name | 1,1-bis[ethyl(hexyl)phosphoryl]-4-isocyanatocyclohexane |
|---|---|
| PubChem CID | 174669471 |
| Molecular Formula | C23H45NO3P2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.29 |
| IUPAC Name | 1,1-bis[ethyl(hexyl)phosphoryl]-4-isocyanatocyclohexane |
| SMILES | CCCCCCP(=O)(CC)C1(P(=O)(CC)CCCCCC)CCC(N=C=O)CC1 |
| InChI | InChI=1S/C23H45NO3P2/c1-5-9-11-13-19-28(26,7-3)23(17-15-22(16-18-23)24-21-25)29(27,8-4)20-14-12-10-6-2/h22H,5-20H2,1-4H3 |
| InChIKey | ZPXHSGOFERAMHQ-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|