C21H34N4O4 — CID 174832166
1,4-diisocyanatocyclohexane;1,6-diisocyanatohexane;pentane (PubChem CID 174832166) has the molecular formula C21H34N4O4 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1,4-diisocyanatocyclohexane;1,6-diisocyanatohexane;pentane.
| Compound Name | 1,4-diisocyanatocyclohexane;1,6-diisocyanatohexane;pentane |
|---|---|
| PubChem CID | 174832166 |
| Molecular Formula | C21H34N4O4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 1,4-diisocyanatocyclohexane;1,6-diisocyanatohexane;pentane |
| SMILES | CCCCC.O=C=NC1CCC(N=C=O)CC1.O=C=NCCCCCCN=C=O |
| InChI | InChI=1S/C8H10N2O2.C8H12N2O2.C5H12/c11-5-9-7-1-2-8(4-3-7)10-6-12;11-7-9-5-3-1-2-4-6-10-8-12;1-3-5-4-2/h7-8H,1-4H2;1-6H2;3-5H2,1-2H3 |
| InChIKey | MMHNGJILTOJVBG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|