C38H70N2O2 — CID 98048681
(1R,2R,3S,4S)-3-heptyl-1,2-bis(9-isocyanatononyl)-4-pentylcyclohexane (PubChem CID 98048681) has the molecular formula C38H70N2O2 and a molecular weight of 586.99 g/mol. Its IUPAC name is (1R,2R,3S,4S)-3-heptyl-1,2-bis(9-isocyanatononyl)-4-pentylcyclohexane.
| Compound Name | (1R,2R,3S,4S)-3-heptyl-1,2-bis(9-isocyanatononyl)-4-pentylcyclohexane |
|---|---|
| PubChem CID | 98048681 |
| Molecular Formula | C38H70N2O2 |
| Molecular Weight | 586.99 g/mol |
| Exact Mass | 586.54 |
| IUPAC Name | (1R,2R,3S,4S)-3-heptyl-1,2-bis(9-isocyanatononyl)-4-pentylcyclohexane |
| SMILES | CCCCCCC[C@H]1[C@@H](CCCCC)CC[C@@H](CCCCCCCCCN=C=O)[C@H]1CCCCCCCCCN=C=O |
| InChI | InChI=1S/C38H70N2O2/c1-3-5-7-14-21-27-37-35(25-19-6-4-2)29-30-36(26-20-15-10-8-12-17-23-31-39-33-41)38(37)28-22-16-11-9-13-18-24-32-40-34-42/h35-38H,3-32H2,1-2H3/t35-,36+,37-,38+/m0/s1 |
| InChIKey | AMUBKBXGFDIMDJ-WCTYMAGYSA-N |
| XLogP | 12.10 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.99 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|