2,4-dimethyl-5-oxo-1,3-oxathiolane-2-carboxylic acid

C6H8O4S — CID 23262139

IUPAC2,4-dimethyl-5-oxo-1,3-oxathiolane-2-carboxylic acid
SMILESCC1SC(C)(C(=O)O)OC1=O
InChIInChI=1S/C6H8O4S/c1-3-4(7)10-6(2,11-3)5(8)9/h3H,1-2H3,(H,8,9)
InChIKeyZHVAHULRJZDEDZ-UHFFFAOYSA-N
MW176.19 g/mol
LogP0.47
Rot. Bonds1

About 2,4-dimethyl-5-oxo-1,3-oxathiolane-2-carboxylic acid

2,4-dimethyl-5-oxo-1,3-oxathiolane-2-carboxylic acid (PubChem CID 23262139) has the molecular formula C6H8O4S and a molecular weight of 176.19 g/mol. Its IUPAC name is 2,4-dimethyl-5-oxo-1,3-oxathiolane-2-carboxylic acid.

Molecular Properties

Compound Name2,4-dimethyl-5-oxo-1,3-oxathiolane-2-carboxylic acid
PubChem CID23262139
Molecular FormulaC6H8O4S
Molecular Weight176.19 g/mol
Exact Mass176.01
IUPAC Name2,4-dimethyl-5-oxo-1,3-oxathiolane-2-carboxylic acid
SMILESCC1SC(C)(C(=O)O)OC1=O
InChIInChI=1S/C6H8O4S/c1-3-4(7)10-6(2,11-3)5(8)9/h3H,1-2H3,(H,8,9)
InChIKeyZHVAHULRJZDEDZ-UHFFFAOYSA-N
XLogP0.47
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.19
LogP ≤ 50.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2,4-dimethyl-5-oxo-1,3-oxathiolane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dimethyl-5-oxo-1,3-oxathiolane-2-carboxylic acid?
The IUPAC name of 2,4-dimethyl-5-oxo-1,3-oxathiolane-2-carboxylic acid (CID 23262139) is 2,4-dimethyl-5-oxo-1,3-oxathiolane-2-carboxylic acid.
What is the SMILES notation for 2,4-dimethyl-5-oxo-1,3-oxathiolane-2-carboxylic acid?
The canonical SMILES for 2,4-dimethyl-5-oxo-1,3-oxathiolane-2-carboxylic acid is CC1SC(C)(C(=O)O)OC1=O.
What is the InChIKey of 2,4-dimethyl-5-oxo-1,3-oxathiolane-2-carboxylic acid?
The InChIKey is ZHVAHULRJZDEDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O4S/c1-3-4(7)10-6(2,11-3)5(8)9/h3H,1-2H3,(H,8,9).
What are the key properties of 2,4-dimethyl-5-oxo-1,3-oxathiolane-2-carboxylic acid?
2,4-dimethyl-5-oxo-1,3-oxathiolane-2-carboxylic acid has a molecular weight of 176.19 g/mol, XLogP of 0.47, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-5-oxo-1,3-oxathiolane-2-carboxylic acid is sourced from PubChem (CID 23262139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).